C20H16ClF4N3O4 — CID 155145776
(1R)-N-[(3-chloro-2,4-difluorophenyl)methyl]-13,13-difluoro-6-hydroxy-5,8-dioxo-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide (PubChem CID 155145776) has the molecular formula C20H16ClF4N3O4 and a molecular weight of 473.81 g/mol. Its IUPAC name is (1R)-N-[(3-chloro-2,4-difluorophenyl)methyl]-13,13-difluoro-6-hydroxy-5,8-dioxo-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide.
| Compound Name | (1R)-N-[(3-chloro-2,4-difluorophenyl)methyl]-13,13-difluoro-6-hydroxy-5,8-dioxo-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 155145776 |
| Molecular Formula | C20H16ClF4N3O4 |
| Molecular Weight | 473.81 g/mol |
| Exact Mass | 473.08 |
| IUPAC Name | (1R)-N-[(3-chloro-2,4-difluorophenyl)methyl]-13,13-difluoro-6-hydroxy-5,8-dioxo-2,9-diazatricyclo[7.4.1.02,7]tetradeca-3,6-diene-4-carboxamide |
| SMILES | O=C(NCc1ccc(F)c(Cl)c1F)c1cn2c(c(O)c1=O)C(=O)N1CCCC(F)(F)[C@H]2C1 |
| InChI | InChI=1S/C20H16ClF4N3O4/c21-13-11(22)3-2-9(14(13)23)6-26-18(31)10-7-28-12-8-27(5-1-4-20(12,24)25)19(32)15(28)17(30)16(10)29/h2-3,7,12,30H,1,4-6,8H2,(H,26,31)/t12-/m1/s1 |
| InChIKey | KNXDKSUVZOUFRV-GFCCVEGCSA-N |
| XLogP | 2.84 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.81 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|