C24H26ClF2N3O5 — CID 137448317
(4R)-N-[(3-chloro-2,4-difluorophenyl)methyl]-9-hydroxy-2-[(3R)-5-hydroxypent-1-en-3-yl]-1,8-dioxo-4-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide (PubChem CID 137448317) has the molecular formula C24H26ClF2N3O5 and a molecular weight of 509.94 g/mol. Its IUPAC name is (4R)-N-[(3-chloro-2,4-difluorophenyl)methyl]-9-hydroxy-2-[(3R)-5-hydroxypent-1-en-3-yl]-1,8-dioxo-4-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide.
| Compound Name | (4R)-N-[(3-chloro-2,4-difluorophenyl)methyl]-9-hydroxy-2-[(3R)-5-hydroxypent-1-en-3-yl]-1,8-dioxo-4-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 137448317 |
| Molecular Formula | C24H26ClF2N3O5 |
| Molecular Weight | 509.94 g/mol |
| Exact Mass | 509.15 |
| IUPAC Name | (4R)-N-[(3-chloro-2,4-difluorophenyl)methyl]-9-hydroxy-2-[(3R)-5-hydroxypent-1-en-3-yl]-1,8-dioxo-4-propan-2-yl-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide |
| SMILES | C=C[C@@H](CCO)N1C[C@@H](C(C)C)n2cc(C(=O)NCc3ccc(F)c(Cl)c3F)c(=O)c(O)c2C1=O |
| InChI | InChI=1S/C24H26ClF2N3O5/c1-4-14(7-8-31)29-11-17(12(2)3)30-10-15(21(32)22(33)20(30)24(29)35)23(34)28-9-13-5-6-16(26)18(25)19(13)27/h4-6,10,12,14,17,31,33H,1,7-9,11H2,2-3H3,(H,28,34)/t14-,17-/m0/s1 |
| InChIKey | NYHHYSCHVGFYLA-YOEHRIQHSA-N |
| XLogP | 3.01 |
| TPSA | 111.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.94 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|