C25H24ClF2N3O5 — CID 138527566
(3S,10R,18R)-N-[(3-chloro-2,4-difluorophenyl)methyl]-3-ethenyl-15-hydroxy-14,17-dioxo-4-oxa-1,11-diazatetracyclo[8.7.1.05,18.011,16]octadeca-12,15-diene-13-carboxamide (PubChem CID 138527566) has the molecular formula C25H24ClF2N3O5 and a molecular weight of 519.93 g/mol. Its IUPAC name is (3S,10R,18R)-N-[(3-chloro-2,4-difluorophenyl)methyl]-3-ethenyl-15-hydroxy-14,17-dioxo-4-oxa-1,11-diazatetracyclo[8.7.1.05,18.011,16]octadeca-12,15-diene-13-carboxamide.
| Compound Name | (3S,10R,18R)-N-[(3-chloro-2,4-difluorophenyl)methyl]-3-ethenyl-15-hydroxy-14,17-dioxo-4-oxa-1,11-diazatetracyclo[8.7.1.05,18.011,16]octadeca-12,15-diene-13-carboxamide |
|---|---|
| PubChem CID | 138527566 |
| Molecular Formula | C25H24ClF2N3O5 |
| Molecular Weight | 519.93 g/mol |
| Exact Mass | 519.14 |
| IUPAC Name | (3S,10R,18R)-N-[(3-chloro-2,4-difluorophenyl)methyl]-3-ethenyl-15-hydroxy-14,17-dioxo-4-oxa-1,11-diazatetracyclo[8.7.1.05,18.011,16]octadeca-12,15-diene-13-carboxamide |
| SMILES | C=C[C@H]1CN2C(=O)c3c(O)c(=O)c(C(=O)NCc4ccc(F)c(Cl)c4F)cn3[C@@H]3CCCCC(O1)[C@@H]32 |
| InChI | InChI=1S/C25H24ClF2N3O5/c1-2-13-10-31-20-16(5-3-4-6-17(20)36-13)30-11-14(22(32)23(33)21(30)25(31)35)24(34)29-9-12-7-8-15(27)18(26)19(12)28/h2,7-8,11,13,16-17,20,33H,1,3-6,9-10H2,(H,29,34)/t13-,16+,17?,20+/m0/s1 |
| InChIKey | PKPGXJWRZMQXTA-BAMVWDAESA-N |
| XLogP | 3.31 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.93 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|