C23H22ClF2N3O5 — CID 122597316
(1R,5R,14S)-N-[(3-chloro-2,4-difluorophenyl)methyl]-10-hydroxy-14-methyl-9,12-dioxo-17-oxa-6,13-diazatetracyclo[11.4.0.01,5.06,11]heptadeca-7,10-diene-8-carboxamide (PubChem CID 122597316) has the molecular formula C23H22ClF2N3O5 and a molecular weight of 493.89 g/mol. Its IUPAC name is (1R,5R,14S)-N-[(3-chloro-2,4-difluorophenyl)methyl]-10-hydroxy-14-methyl-9,12-dioxo-17-oxa-6,13-diazatetracyclo[11.4.0.01,5.06,11]heptadeca-7,10-diene-8-carboxamide.
| Compound Name | (1R,5R,14S)-N-[(3-chloro-2,4-difluorophenyl)methyl]-10-hydroxy-14-methyl-9,12-dioxo-17-oxa-6,13-diazatetracyclo[11.4.0.01,5.06,11]heptadeca-7,10-diene-8-carboxamide |
|---|---|
| PubChem CID | 122597316 |
| Molecular Formula | C23H22ClF2N3O5 |
| Molecular Weight | 493.89 g/mol |
| Exact Mass | 493.12 |
| IUPAC Name | (1R,5R,14S)-N-[(3-chloro-2,4-difluorophenyl)methyl]-10-hydroxy-14-methyl-9,12-dioxo-17-oxa-6,13-diazatetracyclo[11.4.0.01,5.06,11]heptadeca-7,10-diene-8-carboxamide |
| SMILES | C[C@H]1CCO[C@]23CCC[C@H]2n2cc(C(=O)NCc4ccc(F)c(Cl)c4F)c(=O)c(O)c2C(=O)N13 |
| InChI | InChI=1S/C23H22ClF2N3O5/c1-11-6-8-34-23-7-2-3-15(23)28-10-13(19(30)20(31)18(28)22(33)29(11)23)21(32)27-9-12-4-5-14(25)16(24)17(12)26/h4-5,10-11,15,31H,2-3,6-9H2,1H3,(H,27,32)/t11-,15+,23+/m0/s1 |
| InChIKey | CMALLVBJWGCACH-HWKBYUMMSA-N |
| XLogP | 3.10 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.89 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|