C22H22ClF2N3O5 — CID 129094872
(1R,10S)-N-[(3-chloro-2,4-difluorophenyl)methyl]-9-ethyl-6-hydroxy-5,8-dioxo-12-oxa-2,9-diazatricyclo[8.5.0.02,7]pentadeca-3,6-diene-4-carboxamide (PubChem CID 129094872) has the molecular formula C22H22ClF2N3O5 and a molecular weight of 481.88 g/mol. Its IUPAC name is (1R,10S)-N-[(3-chloro-2,4-difluorophenyl)methyl]-9-ethyl-6-hydroxy-5,8-dioxo-12-oxa-2,9-diazatricyclo[8.5.0.02,7]pentadeca-3,6-diene-4-carboxamide.
| Compound Name | (1R,10S)-N-[(3-chloro-2,4-difluorophenyl)methyl]-9-ethyl-6-hydroxy-5,8-dioxo-12-oxa-2,9-diazatricyclo[8.5.0.02,7]pentadeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 129094872 |
| Molecular Formula | C22H22ClF2N3O5 |
| Molecular Weight | 481.88 g/mol |
| Exact Mass | 481.12 |
| IUPAC Name | (1R,10S)-N-[(3-chloro-2,4-difluorophenyl)methyl]-9-ethyl-6-hydroxy-5,8-dioxo-12-oxa-2,9-diazatricyclo[8.5.0.02,7]pentadeca-3,6-diene-4-carboxamide |
| SMILES | CCN1C(=O)c2c(O)c(=O)c(C(=O)NCc3ccc(F)c(Cl)c3F)cn2[C@@H]2CCCOC[C@H]21 |
| InChI | InChI=1S/C22H22ClF2N3O5/c1-2-27-15-10-33-7-3-4-14(15)28-9-12(19(29)20(30)18(28)22(27)32)21(31)26-8-11-5-6-13(24)16(23)17(11)25/h5-6,9,14-15,30H,2-4,7-8,10H2,1H3,(H,26,31)/t14-,15-/m1/s1 |
| InChIKey | WERKWLDMVAXFFN-HUUCEWRRSA-N |
| XLogP | 2.61 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.88 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|