C22H24FN3O5 — CID 121422218
(2S,7S)-8-ethyl-N-[(2-fluoro-4-methylphenyl)methyl]-11-hydroxy-9,12-dioxo-5-oxa-1,8-diazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxamide (PubChem CID 121422218) has the molecular formula C22H24FN3O5 and a molecular weight of 429.45 g/mol. Its IUPAC name is (2S,7S)-8-ethyl-N-[(2-fluoro-4-methylphenyl)methyl]-11-hydroxy-9,12-dioxo-5-oxa-1,8-diazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxamide.
| Compound Name | (2S,7S)-8-ethyl-N-[(2-fluoro-4-methylphenyl)methyl]-11-hydroxy-9,12-dioxo-5-oxa-1,8-diazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxamide |
|---|---|
| PubChem CID | 121422218 |
| Molecular Formula | C22H24FN3O5 |
| Molecular Weight | 429.45 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | (2S,7S)-8-ethyl-N-[(2-fluoro-4-methylphenyl)methyl]-11-hydroxy-9,12-dioxo-5-oxa-1,8-diazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxamide |
| SMILES | CCN1C(=O)c2c(O)c(=O)c(C(=O)NCc3ccc(C)cc3F)cn2[C@H]2CCOC[C@H]21 |
| InChI | InChI=1S/C22H24FN3O5/c1-3-25-17-11-31-7-6-16(17)26-10-14(19(27)20(28)18(26)22(25)30)21(29)24-9-13-5-4-12(2)8-15(13)23/h4-5,8,10,16-17,28H,3,6-7,9,11H2,1-2H3,(H,24,29)/t16-,17+/m0/s1 |
| InChIKey | LHPDKXVUMRSWHN-DLBZAZTESA-N |
| XLogP | 1.74 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.45 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |