C23H24F3N3O5 — CID 121422130
(2S,7S)-11-methoxy-9,12-dioxo-8-propyl-N-[(2,4,6-trifluorophenyl)methyl]-5-oxa-1,8-diazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxamide (PubChem CID 121422130) has the molecular formula C23H24F3N3O5 and a molecular weight of 479.46 g/mol. Its IUPAC name is (2S,7S)-11-methoxy-9,12-dioxo-8-propyl-N-[(2,4,6-trifluorophenyl)methyl]-5-oxa-1,8-diazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxamide.
| Compound Name | (2S,7S)-11-methoxy-9,12-dioxo-8-propyl-N-[(2,4,6-trifluorophenyl)methyl]-5-oxa-1,8-diazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxamide |
|---|---|
| PubChem CID | 121422130 |
| Molecular Formula | C23H24F3N3O5 |
| Molecular Weight | 479.46 g/mol |
| Exact Mass | 479.17 |
| IUPAC Name | (2S,7S)-11-methoxy-9,12-dioxo-8-propyl-N-[(2,4,6-trifluorophenyl)methyl]-5-oxa-1,8-diazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxamide |
| SMILES | CCCN1C(=O)c2c(OC)c(=O)c(C(=O)NCc3c(F)cc(F)cc3F)cn2[C@H]2CCOC[C@H]21 |
| InChI | InChI=1S/C23H24F3N3O5/c1-3-5-28-18-11-34-6-4-17(18)29-10-14(20(30)21(33-2)19(29)23(28)32)22(31)27-9-13-15(25)7-12(24)8-16(13)26/h7-8,10,17-18H,3-6,9,11H2,1-2H3,(H,27,31)/t17-,18+/m0/s1 |
| InChIKey | AYNZBXBDZSDSQM-ZWKOTPCHSA-N |
| XLogP | 2.40 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.46 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |