C26H28F3N3O5 — CID 145166273
(3S)-9-methoxy-4-(2-methoxyethyl)-1,8-dioxo-2,3-bis(prop-2-enyl)-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide (PubChem CID 145166273) has the molecular formula C26H28F3N3O5 and a molecular weight of 519.52 g/mol. Its IUPAC name is (3S)-9-methoxy-4-(2-methoxyethyl)-1,8-dioxo-2,3-bis(prop-2-enyl)-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide.
| Compound Name | (3S)-9-methoxy-4-(2-methoxyethyl)-1,8-dioxo-2,3-bis(prop-2-enyl)-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 145166273 |
| Molecular Formula | C26H28F3N3O5 |
| Molecular Weight | 519.52 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | (3S)-9-methoxy-4-(2-methoxyethyl)-1,8-dioxo-2,3-bis(prop-2-enyl)-N-[(2,4,6-trifluorophenyl)methyl]-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxamide |
| SMILES | C=CC[C@H]1C(CCOC)n2cc(C(=O)NCc3c(F)cc(F)cc3F)c(=O)c(OC)c2C(=O)N1CC=C |
| InChI | InChI=1S/C26H28F3N3O5/c1-5-7-20-21(8-10-36-3)32-14-17(23(33)24(37-4)22(32)26(35)31(20)9-6-2)25(34)30-13-16-18(28)11-15(27)12-19(16)29/h5-6,11-12,14,20-21H,1-2,7-10,13H2,3-4H3,(H,30,34)/t20-,21?/m0/s1 |
| InChIKey | YHVOMFZYTKUMSB-BGERDNNASA-N |
| XLogP | 3.37 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.52 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|