C22H22FN3O4 — CID 161499583
(1R,13R)-N-[(2-fluoro-4-methylphenyl)methyl]-6-hydroxy-5,8-dioxo-2,9-diazatetracyclo[7.5.1.01,13.02,7]pentadeca-3,6-diene-4-carboxamide (PubChem CID 161499583) has the molecular formula C22H22FN3O4 and a molecular weight of 411.43 g/mol. Its IUPAC name is (1R,13R)-N-[(2-fluoro-4-methylphenyl)methyl]-6-hydroxy-5,8-dioxo-2,9-diazatetracyclo[7.5.1.01,13.02,7]pentadeca-3,6-diene-4-carboxamide.
| Compound Name | (1R,13R)-N-[(2-fluoro-4-methylphenyl)methyl]-6-hydroxy-5,8-dioxo-2,9-diazatetracyclo[7.5.1.01,13.02,7]pentadeca-3,6-diene-4-carboxamide |
|---|---|
| PubChem CID | 161499583 |
| Molecular Formula | C22H22FN3O4 |
| Molecular Weight | 411.43 g/mol |
| Exact Mass | 411.16 |
| IUPAC Name | (1R,13R)-N-[(2-fluoro-4-methylphenyl)methyl]-6-hydroxy-5,8-dioxo-2,9-diazatetracyclo[7.5.1.01,13.02,7]pentadeca-3,6-diene-4-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2cn3c(c(O)c2=O)C(=O)N2CCC[C@@H]4C[C@]43C2)c(F)c1 |
| InChI | InChI=1S/C22H22FN3O4/c1-12-4-5-13(16(23)7-12)9-24-20(29)15-10-26-17(19(28)18(15)27)21(30)25-6-2-3-14-8-22(14,26)11-25/h4-5,7,10,14,28H,2-3,6,8-9,11H2,1H3,(H,24,29)/t14-,22+/m1/s1 |
| InChIKey | NPMGTAFMIYIPGD-PEBXRYMYSA-N |
| XLogP | 1.90 |
| TPSA | 91.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.43 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |