C22H25FN4O4 — CID 66596578
10-butoxy-N-[(4-fluorophenyl)methyl]-8,11-dioxo-1,4,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide (PubChem CID 66596578) has the molecular formula C22H25FN4O4 and a molecular weight of 428.46 g/mol. Its IUPAC name is 10-butoxy-N-[(4-fluorophenyl)methyl]-8,11-dioxo-1,4,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide.
| Compound Name | 10-butoxy-N-[(4-fluorophenyl)methyl]-8,11-dioxo-1,4,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
|---|---|
| PubChem CID | 66596578 |
| Molecular Formula | C22H25FN4O4 |
| Molecular Weight | 428.46 g/mol |
| Exact Mass | 428.19 |
| IUPAC Name | 10-butoxy-N-[(4-fluorophenyl)methyl]-8,11-dioxo-1,4,7-triazatricyclo[7.4.0.03,7]trideca-9,12-diene-12-carboxamide |
| SMILES | CCCCOc1c2n(cc(C(=O)NCc3ccc(F)cc3)c1=O)CC1NCCN1C2=O |
| InChI | InChI=1S/C22H25FN4O4/c1-2-3-10-31-20-18-22(30)27-9-8-24-17(27)13-26(18)12-16(19(20)28)21(29)25-11-14-4-6-15(23)7-5-14/h4-7,12,17,24H,2-3,8-11,13H2,1H3,(H,25,29) |
| InChIKey | MAQRMJBPTKQIRN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.46 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|