C21H28N2O5 — CID 90328291
ethyl (11S)-5-butoxy-3,6-dioxo-2,9-diazatetracyclo[10.2.2.02,11.04,9]hexadeca-4,7-diene-7-carboxylate (PubChem CID 90328291) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is ethyl (11S)-5-butoxy-3,6-dioxo-2,9-diazatetracyclo[10.2.2.02,11.04,9]hexadeca-4,7-diene-7-carboxylate.
| Compound Name | ethyl (11S)-5-butoxy-3,6-dioxo-2,9-diazatetracyclo[10.2.2.02,11.04,9]hexadeca-4,7-diene-7-carboxylate |
|---|---|
| PubChem CID | 90328291 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | ethyl (11S)-5-butoxy-3,6-dioxo-2,9-diazatetracyclo[10.2.2.02,11.04,9]hexadeca-4,7-diene-7-carboxylate |
| SMILES | CCCCOc1c2n(cc(C(=O)OCC)c1=O)C[C@@H]1C3CCC(CC3)N1C2=O |
| InChI | InChI=1S/C21H28N2O5/c1-3-5-10-28-19-17-20(25)23-14-8-6-13(7-9-14)16(23)12-22(17)11-15(18(19)24)21(26)27-4-2/h11,13-14,16H,3-10,12H2,1-2H3/t13?,14?,16-/m1/s1 |
| InChIKey | FMOLFIOIDMWAGE-ZBCRRDGASA-N |
| XLogP | 2.60 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|