C19H27NO8 — CID 130359984
diethyl 3-butoxy-1-(1,3-dioxolan-2-ylmethyl)-4-oxopyridine-2,5-dicarboxylate (PubChem CID 130359984) has the molecular formula C19H27NO8 and a molecular weight of 397.42 g/mol. Its IUPAC name is diethyl 3-butoxy-1-(1,3-dioxolan-2-ylmethyl)-4-oxopyridine-2,5-dicarboxylate.
| Compound Name | diethyl 3-butoxy-1-(1,3-dioxolan-2-ylmethyl)-4-oxopyridine-2,5-dicarboxylate |
|---|---|
| PubChem CID | 130359984 |
| Molecular Formula | C19H27NO8 |
| Molecular Weight | 397.42 g/mol |
| Exact Mass | 397.17 |
| IUPAC Name | diethyl 3-butoxy-1-(1,3-dioxolan-2-ylmethyl)-4-oxopyridine-2,5-dicarboxylate |
| SMILES | CCCCOc1c(C(=O)OCC)n(CC2OCCO2)cc(C(=O)OCC)c1=O |
| InChI | InChI=1S/C19H27NO8/c1-4-7-8-28-17-15(19(23)25-6-3)20(12-14-26-9-10-27-14)11-13(16(17)21)18(22)24-5-2/h11,14H,4-10,12H2,1-3H3 |
| InChIKey | VNWOAAOGRKVPPX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 102.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.42 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|