C15H20O7 — CID 87412030
ethyl 5-butoxy-6-(4-methyl-1,3-dioxetan-2-yl)-4-oxopyran-3-carboxylate (PubChem CID 87412030) has the molecular formula C15H20O7 and a molecular weight of 312.32 g/mol. Its IUPAC name is ethyl 5-butoxy-6-(4-methyl-1,3-dioxetan-2-yl)-4-oxopyran-3-carboxylate.
| Compound Name | ethyl 5-butoxy-6-(4-methyl-1,3-dioxetan-2-yl)-4-oxopyran-3-carboxylate |
|---|---|
| PubChem CID | 87412030 |
| Molecular Formula | C15H20O7 |
| Molecular Weight | 312.32 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | ethyl 5-butoxy-6-(4-methyl-1,3-dioxetan-2-yl)-4-oxopyran-3-carboxylate |
| SMILES | CCCCOc1c(C2OC(C)O2)occ(C(=O)OCC)c1=O |
| InChI | InChI=1S/C15H20O7/c1-4-6-7-19-12-11(16)10(14(17)18-5-2)8-20-13(12)15-21-9(3)22-15/h8-9,15H,4-7H2,1-3H3 |
| InChIKey | NQIHMGDZUOGGST-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 84.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.32 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|