About ethyl 2,4-dibromo-5-(4-methyl-1,3-dioxetan-2-yl)benzoate
ethyl 2,4-dibromo-5-(4-methyl-1,3-dioxetan-2-yl)benzoate (PubChem CID 70669561) has the molecular formula C12H12Br2O4
and a molecular weight of 380.03 g/mol. Its IUPAC name is ethyl 2,4-dibromo-5-(4-methyl-1,3-dioxetan-2-yl)benzoate.
Molecular Properties
| Compound Name | ethyl 2,4-dibromo-5-(4-methyl-1,3-dioxetan-2-yl)benzoate |
| PubChem CID | 70669561 |
| Molecular Formula | C12H12Br2O4 |
| Molecular Weight | 380.03 g/mol |
| Exact Mass | 377.91 |
| IUPAC Name | ethyl 2,4-dibromo-5-(4-methyl-1,3-dioxetan-2-yl)benzoate |
| SMILES | CCOC(=O)c1cc(C2OC(C)O2)c(Br)cc1Br |
| InChI | InChI=1S/C12H12Br2O4/c1-3-16-11(15)7-4-8(10(14)5-9(7)13)12-17-6(2)18-12/h4-6,12H,3H2,1-2H3 |
| InChIKey | ISFMJBPPJIAQFW-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.03 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2,4-dibromo-5-(4-methyl-1,3-dioxetan-2-yl)benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2,4-dibromo-5-(4-methyl-1,3-dioxetan-2-yl)benzoate?
The IUPAC name of ethyl 2,4-dibromo-5-(4-methyl-1,3-dioxetan-2-yl)benzoate (CID 70669561) is ethyl 2,4-dibromo-5-(4-methyl-1,3-dioxetan-2-yl)benzoate.
What is the SMILES notation for ethyl 2,4-dibromo-5-(4-methyl-1,3-dioxetan-2-yl)benzoate?
The canonical SMILES for ethyl 2,4-dibromo-5-(4-methyl-1,3-dioxetan-2-yl)benzoate is CCOC(=O)c1cc(C2OC(C)O2)c(Br)cc1Br.
What is the InChIKey of ethyl 2,4-dibromo-5-(4-methyl-1,3-dioxetan-2-yl)benzoate?
The InChIKey is ISFMJBPPJIAQFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12Br2O4/c1-3-16-11(15)7-4-8(10(14)5-9(7)13)12-17-6(2)18-12/h4-6,12H,3H2,1-2H3.
What are the key properties of ethyl 2,4-dibromo-5-(4-methyl-1,3-dioxetan-2-yl)benzoate?
ethyl 2,4-dibromo-5-(4-methyl-1,3-dioxetan-2-yl)benzoate has a molecular weight of 380.03 g/mol, XLogP of 3.78, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2,4-dibromo-5-(4-methyl-1,3-dioxetan-2-yl)benzoate is sourced from PubChem (CID 70669561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).