C14H20N2O5 — CID 71136905
ethyl 4-(3-aminopropoxy)-6-(4-methyl-1,3-dioxetan-2-yl)pyridine-2-carboxylate (PubChem CID 71136905) has the molecular formula C14H20N2O5 and a molecular weight of 296.32 g/mol. Its IUPAC name is ethyl 4-(3-aminopropoxy)-6-(4-methyl-1,3-dioxetan-2-yl)pyridine-2-carboxylate.
| Compound Name | ethyl 4-(3-aminopropoxy)-6-(4-methyl-1,3-dioxetan-2-yl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 71136905 |
| Molecular Formula | C14H20N2O5 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.14 |
| IUPAC Name | ethyl 4-(3-aminopropoxy)-6-(4-methyl-1,3-dioxetan-2-yl)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cc(OCCCN)cc(C2OC(C)O2)n1 |
| InChI | InChI=1S/C14H20N2O5/c1-3-18-13(17)11-7-10(19-6-4-5-15)8-12(16-11)14-20-9(2)21-14/h7-9,14H,3-6,15H2,1-2H3 |
| InChIKey | VPARHHDGTCITJO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 92.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|