C18H27NO5S2 — CID 86671278
diethyl 4-[4-methyl-4-(methyldisulfanyl)pentoxy]pyridine-2,6-dicarboxylate (PubChem CID 86671278) has the molecular formula C18H27NO5S2 and a molecular weight of 401.55 g/mol. Its IUPAC name is diethyl 4-[4-methyl-4-(methyldisulfanyl)pentoxy]pyridine-2,6-dicarboxylate.
| Compound Name | diethyl 4-[4-methyl-4-(methyldisulfanyl)pentoxy]pyridine-2,6-dicarboxylate |
|---|---|
| PubChem CID | 86671278 |
| Molecular Formula | C18H27NO5S2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.13 |
| IUPAC Name | diethyl 4-[4-methyl-4-(methyldisulfanyl)pentoxy]pyridine-2,6-dicarboxylate |
| SMILES | CCOC(=O)c1cc(OCCCC(C)(C)SSC)cc(C(=O)OCC)n1 |
| InChI | InChI=1S/C18H27NO5S2/c1-6-22-16(20)14-11-13(12-15(19-14)17(21)23-7-2)24-10-8-9-18(3,4)26-25-5/h11-12H,6-10H2,1-5H3 |
| InChIKey | ONPPJAGHQNRSJS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|