C14H19NO5S2 — CID 171429232
4-[4-methyl-4-(methyldisulfanyl)pentoxy]pyridine-2,6-dicarboxylic acid (PubChem CID 171429232) has the molecular formula C14H19NO5S2 and a molecular weight of 345.44 g/mol. Its IUPAC name is 4-[4-methyl-4-(methyldisulfanyl)pentoxy]pyridine-2,6-dicarboxylic acid.
| Compound Name | 4-[4-methyl-4-(methyldisulfanyl)pentoxy]pyridine-2,6-dicarboxylic acid |
|---|---|
| PubChem CID | 171429232 |
| Molecular Formula | C14H19NO5S2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 4-[4-methyl-4-(methyldisulfanyl)pentoxy]pyridine-2,6-dicarboxylic acid |
| SMILES | CSSC(C)(C)CCCOc1cc(C(=O)O)nc(C(=O)O)c1 |
| InChI | InChI=1S/C14H19NO5S2/c1-14(2,22-21-3)5-4-6-20-9-7-10(12(16)17)15-11(8-9)13(18)19/h7-8H,4-6H2,1-3H3,(H,16,17)(H,18,19) |
| InChIKey | KJCHVTUDPORVDI-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 96.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|