C17H27N3O4S2 — CID 163747525
N-[3-[[2-(hydroxymethyl)-6-(nitrosomethyl)-4-pyridinyl]oxy]propyl]-4-methyl-4-(methyldisulfanyl)pentanamide (PubChem CID 163747525) has the molecular formula C17H27N3O4S2 and a molecular weight of 401.55 g/mol. Its IUPAC name is N-[3-[[2-(hydroxymethyl)-6-(nitrosomethyl)-4-pyridinyl]oxy]propyl]-4-methyl-4-(methyldisulfanyl)pentanamide.
| Compound Name | N-[3-[[2-(hydroxymethyl)-6-(nitrosomethyl)-4-pyridinyl]oxy]propyl]-4-methyl-4-(methyldisulfanyl)pentanamide |
|---|---|
| PubChem CID | 163747525 |
| Molecular Formula | C17H27N3O4S2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | N-[3-[[2-(hydroxymethyl)-6-(nitrosomethyl)-4-pyridinyl]oxy]propyl]-4-methyl-4-(methyldisulfanyl)pentanamide |
| SMILES | CSSC(C)(C)CCC(=O)NCCCOc1cc(CO)nc(CN=O)c1 |
| InChI | InChI=1S/C17H27N3O4S2/c1-17(2,26-25-3)6-5-16(22)18-7-4-8-24-15-9-13(11-19-23)20-14(10-15)12-21/h9-10,21H,4-8,11-12H2,1-3H3,(H,18,22) |
| InChIKey | LNDAPEOXECOBKA-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|