C19H31N3O3S2 — CID 143515763
N-[5-[2-(hydroxymethyl)-6-(nitrosomethyl)-4-pyridinyl]pentyl]-4-methyl-4-(methyldisulfanyl)pentanamide (PubChem CID 143515763) has the molecular formula C19H31N3O3S2 and a molecular weight of 413.61 g/mol. Its IUPAC name is N-[5-[2-(hydroxymethyl)-6-(nitrosomethyl)-4-pyridinyl]pentyl]-4-methyl-4-(methyldisulfanyl)pentanamide.
| Compound Name | N-[5-[2-(hydroxymethyl)-6-(nitrosomethyl)-4-pyridinyl]pentyl]-4-methyl-4-(methyldisulfanyl)pentanamide |
|---|---|
| PubChem CID | 143515763 |
| Molecular Formula | C19H31N3O3S2 |
| Molecular Weight | 413.61 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | N-[5-[2-(hydroxymethyl)-6-(nitrosomethyl)-4-pyridinyl]pentyl]-4-methyl-4-(methyldisulfanyl)pentanamide |
| SMILES | CSSC(C)(C)CCC(=O)NCCCCCc1cc(CO)nc(CN=O)c1 |
| InChI | InChI=1S/C19H31N3O3S2/c1-19(2,27-26-3)9-8-18(24)20-10-6-4-5-7-15-11-16(13-21-25)22-17(12-15)14-23/h11-12,23H,4-10,13-14H2,1-3H3,(H,20,24) |
| InChIKey | GIRDUBRONVKGPS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.61 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|