C20H27N3O2S — CID 46524305
3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)-N-[3-(3-methylphenoxy)propyl]propanamide (PubChem CID 46524305) has the molecular formula C20H27N3O2S and a molecular weight of 373.52 g/mol. Its IUPAC name is 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)-N-[3-(3-methylphenoxy)propyl]propanamide.
| Compound Name | 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)-N-[3-(3-methylphenoxy)propyl]propanamide |
|---|---|
| PubChem CID | 46524305 |
| Molecular Formula | C20H27N3O2S |
| Molecular Weight | 373.52 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)-N-[3-(3-methylphenoxy)propyl]propanamide |
| SMILES | CSc1nc(C)c(CCC(=O)NCCCOc2cccc(C)c2)c(C)n1 |
| InChI | InChI=1S/C20H27N3O2S/c1-14-7-5-8-17(13-14)25-12-6-11-21-19(24)10-9-18-15(2)22-20(26-4)23-16(18)3/h5,7-8,13H,6,9-12H2,1-4H3,(H,21,24) |
| InChIKey | BYQVEGRZTVNSBV-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.52 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|