C22H30N4O3S — CID 55801680
3-[3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoylamino]-N-(3-ethoxypropyl)benzamide (PubChem CID 55801680) has the molecular formula C22H30N4O3S and a molecular weight of 430.57 g/mol. Its IUPAC name is 3-[3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoylamino]-N-(3-ethoxypropyl)benzamide.
| Compound Name | 3-[3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoylamino]-N-(3-ethoxypropyl)benzamide |
|---|---|
| PubChem CID | 55801680 |
| Molecular Formula | C22H30N4O3S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 3-[3-(4,6-dimethyl-2-methylsulfanylpyrimidin-5-yl)propanoylamino]-N-(3-ethoxypropyl)benzamide |
| SMILES | CCOCCCNC(=O)c1cccc(NC(=O)CCc2c(C)nc(SC)nc2C)c1 |
| InChI | InChI=1S/C22H30N4O3S/c1-5-29-13-7-12-23-21(28)17-8-6-9-18(14-17)26-20(27)11-10-19-15(2)24-22(30-4)25-16(19)3/h6,8-9,14H,5,7,10-13H2,1-4H3,(H,23,28)(H,26,27) |
| InChIKey | BTGQQZGCDQXDJP-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|