C22H27N3O5 — CID 55801513
ethyl 6-[[3-(3-ethoxypropylcarbamoyl)phenyl]carbamoyl]-2-methylpyridine-3-carboxylate (PubChem CID 55801513) has the molecular formula C22H27N3O5 and a molecular weight of 413.47 g/mol. Its IUPAC name is ethyl 6-[[3-(3-ethoxypropylcarbamoyl)phenyl]carbamoyl]-2-methylpyridine-3-carboxylate.
| Compound Name | ethyl 6-[[3-(3-ethoxypropylcarbamoyl)phenyl]carbamoyl]-2-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 55801513 |
| Molecular Formula | C22H27N3O5 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.20 |
| IUPAC Name | ethyl 6-[[3-(3-ethoxypropylcarbamoyl)phenyl]carbamoyl]-2-methylpyridine-3-carboxylate |
| SMILES | CCOCCCNC(=O)c1cccc(NC(=O)c2ccc(C(=O)OCC)c(C)n2)c1 |
| InChI | InChI=1S/C22H27N3O5/c1-4-29-13-7-12-23-20(26)16-8-6-9-17(14-16)25-21(27)19-11-10-18(15(3)24-19)22(28)30-5-2/h6,8-11,14H,4-5,7,12-13H2,1-3H3,(H,23,26)(H,25,27) |
| InChIKey | YGURBWAFQUZALG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|