C21H26N2O4 — CID 87005156
N-(3-ethoxypropyl)-3-[[2-(3-methylphenoxy)acetyl]amino]benzamide (PubChem CID 87005156) has the molecular formula C21H26N2O4 and a molecular weight of 370.45 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-3-[[2-(3-methylphenoxy)acetyl]amino]benzamide.
| Compound Name | N-(3-ethoxypropyl)-3-[[2-(3-methylphenoxy)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 87005156 |
| Molecular Formula | C21H26N2O4 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | N-(3-ethoxypropyl)-3-[[2-(3-methylphenoxy)acetyl]amino]benzamide |
| SMILES | CCOCCCNC(=O)c1cccc(NC(=O)COc2cccc(C)c2)c1 |
| InChI | InChI=1S/C21H26N2O4/c1-3-26-12-6-11-22-21(25)17-8-5-9-18(14-17)23-20(24)15-27-19-10-4-7-16(2)13-19/h4-5,7-10,13-14H,3,6,11-12,15H2,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | AAMWYHVVSZBVRG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|