C24H32N2O4 — CID 55802015
3-[[2-(2-butan-2-ylphenoxy)acetyl]amino]-N-(3-ethoxypropyl)benzamide (PubChem CID 55802015) has the molecular formula C24H32N2O4 and a molecular weight of 412.53 g/mol. Its IUPAC name is 3-[[2-(2-butan-2-ylphenoxy)acetyl]amino]-N-(3-ethoxypropyl)benzamide.
| Compound Name | 3-[[2-(2-butan-2-ylphenoxy)acetyl]amino]-N-(3-ethoxypropyl)benzamide |
|---|---|
| PubChem CID | 55802015 |
| Molecular Formula | C24H32N2O4 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.24 |
| IUPAC Name | 3-[[2-(2-butan-2-ylphenoxy)acetyl]amino]-N-(3-ethoxypropyl)benzamide |
| SMILES | CCOCCCNC(=O)c1cccc(NC(=O)COc2ccccc2C(C)CC)c1 |
| InChI | InChI=1S/C24H32N2O4/c1-4-18(3)21-12-6-7-13-22(21)30-17-23(27)26-20-11-8-10-19(16-20)24(28)25-14-9-15-29-5-2/h6-8,10-13,16,18H,4-5,9,14-15,17H2,1-3H3,(H,25,28)(H,26,27) |
| InChIKey | PJKFIEDPERVVDY-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|