C18H29NO3 — CID 86907773
2-(2-butan-2-ylphenoxy)-N-(3-propan-2-yloxypropyl)acetamide (PubChem CID 86907773) has the molecular formula C18H29NO3 and a molecular weight of 307.43 g/mol. Its IUPAC name is 2-(2-butan-2-ylphenoxy)-N-(3-propan-2-yloxypropyl)acetamide.
| Compound Name | 2-(2-butan-2-ylphenoxy)-N-(3-propan-2-yloxypropyl)acetamide |
|---|---|
| PubChem CID | 86907773 |
| Molecular Formula | C18H29NO3 |
| Molecular Weight | 307.43 g/mol |
| Exact Mass | 307.21 |
| IUPAC Name | 2-(2-butan-2-ylphenoxy)-N-(3-propan-2-yloxypropyl)acetamide |
| SMILES | CCC(C)c1ccccc1OCC(=O)NCCCOC(C)C |
| InChI | InChI=1S/C18H29NO3/c1-5-15(4)16-9-6-7-10-17(16)22-13-18(20)19-11-8-12-21-14(2)3/h6-7,9-10,14-15H,5,8,11-13H2,1-4H3,(H,19,20) |
| InChIKey | JSQZIROULWYBGW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.43 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|