C19H23F2N3O2S — CID 9456624
3-[2-(difluoromethylsulfanyl)-4,6-dimethylpyrimidin-5-yl]-N-[2-(4-methylphenoxy)ethyl]propanamide (PubChem CID 9456624) has the molecular formula C19H23F2N3O2S and a molecular weight of 395.48 g/mol. Its IUPAC name is 3-[2-(difluoromethylsulfanyl)-4,6-dimethylpyrimidin-5-yl]-N-[2-(4-methylphenoxy)ethyl]propanamide.
| Compound Name | 3-[2-(difluoromethylsulfanyl)-4,6-dimethylpyrimidin-5-yl]-N-[2-(4-methylphenoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 9456624 |
| Molecular Formula | C19H23F2N3O2S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 3-[2-(difluoromethylsulfanyl)-4,6-dimethylpyrimidin-5-yl]-N-[2-(4-methylphenoxy)ethyl]propanamide |
| SMILES | Cc1ccc(OCCNC(=O)CCc2c(C)nc(SC(F)F)nc2C)cc1 |
| InChI | InChI=1S/C19H23F2N3O2S/c1-12-4-6-15(7-5-12)26-11-10-22-17(25)9-8-16-13(2)23-19(24-14(16)3)27-18(20)21/h4-7,18H,8-11H2,1-3H3,(H,22,25) |
| InChIKey | HZTHGMVTIZLDSZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|