C24H26N4O2 — CID 41331787
3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)-N-[2-(3-methylphenoxy)ethyl]propanamide (PubChem CID 41331787) has the molecular formula C24H26N4O2 and a molecular weight of 402.50 g/mol. Its IUPAC name is 3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)-N-[2-(3-methylphenoxy)ethyl]propanamide.
| Compound Name | 3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)-N-[2-(3-methylphenoxy)ethyl]propanamide |
|---|---|
| PubChem CID | 41331787 |
| Molecular Formula | C24H26N4O2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.21 |
| IUPAC Name | 3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)-N-[2-(3-methylphenoxy)ethyl]propanamide |
| SMILES | Cc1cccc(OCCNC(=O)CCc2c(C)nc3c4ccccc4nn3c2C)c1 |
| InChI | InChI=1S/C24H26N4O2/c1-16-7-6-8-19(15-16)30-14-13-25-23(29)12-11-20-17(2)26-24-21-9-4-5-10-22(21)27-28(24)18(20)3/h4-10,15H,11-14H2,1-3H3,(H,25,29) |
| InChIKey | MZSZKIRQTVEPDA-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 68.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|