C26H31N5O2 — CID 86898251
N-[4-[3-(dimethylamino)propoxy]phenyl]-3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)propanamide (PubChem CID 86898251) has the molecular formula C26H31N5O2 and a molecular weight of 445.57 g/mol. Its IUPAC name is N-[4-[3-(dimethylamino)propoxy]phenyl]-3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)propanamide.
| Compound Name | N-[4-[3-(dimethylamino)propoxy]phenyl]-3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)propanamide |
|---|---|
| PubChem CID | 86898251 |
| Molecular Formula | C26H31N5O2 |
| Molecular Weight | 445.57 g/mol |
| Exact Mass | 445.25 |
| IUPAC Name | N-[4-[3-(dimethylamino)propoxy]phenyl]-3-(2,4-dimethylpyrimido[1,2-b]indazol-3-yl)propanamide |
| SMILES | Cc1nc2c3ccccc3nn2c(C)c1CCC(=O)Nc1ccc(OCCCN(C)C)cc1 |
| InChI | InChI=1S/C26H31N5O2/c1-18-22(19(2)31-26(27-18)23-8-5-6-9-24(23)29-31)14-15-25(32)28-20-10-12-21(13-11-20)33-17-7-16-30(3)4/h5-6,8-13H,7,14-17H2,1-4H3,(H,28,32) |
| InChIKey | UGPPCSQPPZSKFV-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 71.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|