C19H24F2N2O6 — CID 121425122
ethyl (2R,7R)-11-butoxy-7-(difluoromethyl)-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxylate (PubChem CID 121425122) has the molecular formula C19H24F2N2O6 and a molecular weight of 414.41 g/mol. Its IUPAC name is ethyl (2R,7R)-11-butoxy-7-(difluoromethyl)-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxylate.
| Compound Name | ethyl (2R,7R)-11-butoxy-7-(difluoromethyl)-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxylate |
|---|---|
| PubChem CID | 121425122 |
| Molecular Formula | C19H24F2N2O6 |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | ethyl (2R,7R)-11-butoxy-7-(difluoromethyl)-9,12-dioxo-4-oxa-1,8-diazatricyclo[8.4.0.02,7]tetradeca-10,13-diene-13-carboxylate |
| SMILES | CCCCOc1c2n(cc(C(=O)OCC)c1=O)[C@H]1COCC[C@@]1(C(F)F)NC2=O |
| InChI | InChI=1S/C19H24F2N2O6/c1-3-5-7-29-15-13-16(25)22-19(18(20)21)6-8-27-10-12(19)23(13)9-11(14(15)24)17(26)28-4-2/h9,12,18H,3-8,10H2,1-2H3,(H,22,25)/t12-,19+/m0/s1 |
| InChIKey | UKAHTIXCOWQROM-HXPMCKFVSA-N |
| XLogP | 1.91 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|