C17H24N4O4 — CID 156704126
(3R)-11-hexoxy-6-methyl-1,2,6,8-tetrazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-5,9,12-trione (PubChem CID 156704126) has the molecular formula C17H24N4O4 and a molecular weight of 348.40 g/mol. Its IUPAC name is (3R)-11-hexoxy-6-methyl-1,2,6,8-tetrazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-5,9,12-trione.
| Compound Name | (3R)-11-hexoxy-6-methyl-1,2,6,8-tetrazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-5,9,12-trione |
|---|---|
| PubChem CID | 156704126 |
| Molecular Formula | C17H24N4O4 |
| Molecular Weight | 348.40 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (3R)-11-hexoxy-6-methyl-1,2,6,8-tetrazatricyclo[8.4.0.03,8]tetradeca-10,13-diene-5,9,12-trione |
| SMILES | CCCCCCOc1c2n(ccc1=O)N[C@@H]1CC(=O)N(C)CN1C2=O |
| InChI | InChI=1S/C17H24N4O4/c1-3-4-5-6-9-25-16-12(22)7-8-21-15(16)17(24)20-11-19(2)14(23)10-13(20)18-21/h7-8,13,18H,3-6,9-11H2,1-2H3/t13-/m0/s1 |
| InChIKey | HNFWEKMWOAQACF-ZDUSSCGKSA-N |
| XLogP | 0.95 |
| TPSA | 83.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.40 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|