C27H28N2O5 — CID 67471619
(3R)-3-benzhydryl-9-butoxy-2-methyl-1,8-dioxo-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxylic acid (PubChem CID 67471619) has the molecular formula C27H28N2O5 and a molecular weight of 460.53 g/mol. Its IUPAC name is (3R)-3-benzhydryl-9-butoxy-2-methyl-1,8-dioxo-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxylic acid.
| Compound Name | (3R)-3-benzhydryl-9-butoxy-2-methyl-1,8-dioxo-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxylic acid |
|---|---|
| PubChem CID | 67471619 |
| Molecular Formula | C27H28N2O5 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.20 |
| IUPAC Name | (3R)-3-benzhydryl-9-butoxy-2-methyl-1,8-dioxo-3,4-dihydropyrido[1,2-a]pyrazine-7-carboxylic acid |
| SMILES | CCCCOc1c2n(cc(C(=O)O)c1=O)C[C@@H](C(c1ccccc1)c1ccccc1)N(C)C2=O |
| InChI | InChI=1S/C27H28N2O5/c1-3-4-15-34-25-23-26(31)28(2)21(17-29(23)16-20(24(25)30)27(32)33)22(18-11-7-5-8-12-18)19-13-9-6-10-14-19/h5-14,16,21-22H,3-4,15,17H2,1-2H3,(H,32,33)/t21-/m0/s1 |
| InChIKey | UJVIMXJJUAVVKL-NRFANRHFSA-N |
| XLogP | 4.01 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|