C23H16NO6S- — CID 172974156
4-[(4E)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzenesulfonate (PubChem CID 172974156) has the molecular formula C23H16NO6S- and a molecular weight of 434.45 g/mol. Its IUPAC name is 4-[(4E)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzenesulfonate.
| Compound Name | 4-[(4E)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzenesulfonate |
|---|---|
| PubChem CID | 172974156 |
| Molecular Formula | C23H16NO6S- |
| Molecular Weight | 434.45 g/mol |
| Exact Mass | 434.07 |
| IUPAC Name | 4-[(4E)-4-[hydroxy(phenyl)methylidene]-2,3-dioxo-5-phenylpyrrolidin-1-yl]benzenesulfonate |
| SMILES | O=C1C(=O)N(c2ccc(S(=O)(=O)[O-])cc2)C(c2ccccc2)/C1=C(\O)c1ccccc1 |
| InChI | InChI=1S/C23H17NO6S/c25-21(16-9-5-2-6-10-16)19-20(15-7-3-1-4-8-15)24(23(27)22(19)26)17-11-13-18(14-12-17)31(28,29)30/h1-14,20,25H,(H,28,29,30)/p-1/b21-19+ |
| InChIKey | JQOPWHOSHCFTLX-XUTLUUPISA-M |
| XLogP | 3.22 |
| TPSA | 114.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.45 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|