C23H17NO4 — CID 98335436
(4Z,5R)-1-(4-hydroxyphenyl)-4-[hydroxy(phenyl)methylidene]-5-phenylpyrrolidine-2,3-dione (PubChem CID 98335436) has the molecular formula C23H17NO4 and a molecular weight of 371.39 g/mol. Its IUPAC name is (4Z,5R)-1-(4-hydroxyphenyl)-4-[hydroxy(phenyl)methylidene]-5-phenylpyrrolidine-2,3-dione.
| Compound Name | (4Z,5R)-1-(4-hydroxyphenyl)-4-[hydroxy(phenyl)methylidene]-5-phenylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 98335436 |
| Molecular Formula | C23H17NO4 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | (4Z,5R)-1-(4-hydroxyphenyl)-4-[hydroxy(phenyl)methylidene]-5-phenylpyrrolidine-2,3-dione |
| SMILES | O=C1C(=O)N(c2ccc(O)cc2)[C@H](c2ccccc2)/C1=C(/O)c1ccccc1 |
| InChI | InChI=1S/C23H17NO4/c25-18-13-11-17(12-14-18)24-20(15-7-3-1-4-8-15)19(22(27)23(24)28)21(26)16-9-5-2-6-10-16/h1-14,20,25-26H/b21-19-/t20-/m1/s1 |
| InChIKey | PUZNUNAVSUVFIY-GOBJLOIFSA-N |
| XLogP | 4.02 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|