C25H20N5O5- — CID 172975462
(8S)-6-[(E)-[5-[3-[hydroxy(oxido)amino]phenyl]furan-2-yl]methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione (PubChem CID 172975462) has the molecular formula C25H20N5O5- and a molecular weight of 470.47 g/mol. Its IUPAC name is (8S)-6-[(E)-[5-[3-[hydroxy(oxido)amino]phenyl]furan-2-yl]methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione.
| Compound Name | (8S)-6-[(E)-[5-[3-[hydroxy(oxido)amino]phenyl]furan-2-yl]methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
|---|---|
| PubChem CID | 172975462 |
| Molecular Formula | C25H20N5O5- |
| Molecular Weight | 470.47 g/mol |
| Exact Mass | 470.15 |
| IUPAC Name | (8S)-6-[(E)-[5-[3-[hydroxy(oxido)amino]phenyl]furan-2-yl]methylideneamino]-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraene-4,7-dione |
| SMILES | O=C1[C@@H]2Cc3c([nH]c4ccccc34)CN2C(=O)CN1/N=C/c1ccc(-c2cccc(N([O-])O)c2)o1 |
| InChI | InChI=1S/C25H20N5O5/c31-24-14-29(26-12-17-8-9-23(35-17)15-4-3-5-16(10-15)30(33)34)25(32)22-11-19-18-6-1-2-7-20(18)27-21(19)13-28(22)24/h1-10,12,22,27,33H,11,13-14H2/q-1/b26-12+/t22-/m0/s1 |
| InChIKey | PWRFFGVYPUGZOP-ORMFSKTFSA-N |
| XLogP | 3.25 |
| TPSA | 128.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|