C25H39NO6 — CID 172984029
ethyl 2-[(1R,2E,3R,5S)-2-hydroxyimino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]acetate;ethyl 2-[(1R,3R,5S)-6-methyl-2-oxo-3-bicyclo[3.1.1]heptanyl]acetate (PubChem CID 172984029) has the molecular formula C25H39NO6 and a molecular weight of 449.59 g/mol. Its IUPAC name is ethyl 2-[(1R,2E,3R,5S)-2-hydroxyimino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]acetate;ethyl 2-[(1R,3R,5S)-6-methyl-2-oxo-3-bicyclo[3.1.1]heptanyl]acetate.
| Compound Name | ethyl 2-[(1R,2E,3R,5S)-2-hydroxyimino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]acetate;ethyl 2-[(1R,3R,5S)-6-methyl-2-oxo-3-bicyclo[3.1.1]heptanyl]acetate |
|---|---|
| PubChem CID | 172984029 |
| Molecular Formula | C25H39NO6 |
| Molecular Weight | 449.59 g/mol |
| Exact Mass | 449.28 |
| IUPAC Name | ethyl 2-[(1R,2E,3R,5S)-2-hydroxyimino-6,6-dimethyl-3-bicyclo[3.1.1]heptanyl]acetate;ethyl 2-[(1R,3R,5S)-6-methyl-2-oxo-3-bicyclo[3.1.1]heptanyl]acetate |
| SMILES | CCOC(=O)C[C@H]1C[C@H]2C[C@@H](/C1=N/O)C2(C)C.CCOC(=O)C[C@H]1C[C@H]2C[C@@H](C1=O)C2C |
| InChI | InChI=1S/C13H21NO3.C12H18O3/c1-4-17-11(15)6-8-5-9-7-10(12(8)14-16)13(9,2)3;1-3-15-11(13)6-9-4-8-5-10(7(8)2)12(9)14/h8-10,16H,4-7H2,1-3H3;7-10H,3-6H2,1-2H3/b14-12+;/t8-,9+,10+;7?,8-,9+,10+/m10/s1 |
| InChIKey | DDVFXLZSAMSXNU-RPFPRQPMSA-N |
| XLogP | 4.25 |
| TPSA | 102.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.59 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|