C20H21N4O10S- — CID 172986932
(2Z)-N-[(6R,7R)-2-(1-acetyloxyethoxycarbonyl)-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-(furan-3-yl)-2-methoxyiminoethanimidate (PubChem CID 172986932) has the molecular formula C20H21N4O10S- and a molecular weight of 509.47 g/mol. Its IUPAC name is (2Z)-N-[(6R,7R)-2-(1-acetyloxyethoxycarbonyl)-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-(furan-3-yl)-2-methoxyiminoethanimidate.
| Compound Name | (2Z)-N-[(6R,7R)-2-(1-acetyloxyethoxycarbonyl)-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-(furan-3-yl)-2-methoxyiminoethanimidate |
|---|---|
| PubChem CID | 172986932 |
| Molecular Formula | C20H21N4O10S- |
| Molecular Weight | 509.47 g/mol |
| Exact Mass | 509.10 |
| IUPAC Name | (2Z)-N-[(6R,7R)-2-(1-acetyloxyethoxycarbonyl)-3-(carbamoyloxymethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-en-7-yl]-2-(furan-3-yl)-2-methoxyiminoethanimidate |
| SMILES | CO/N=C(C(\[O-])=N\[C@@H]1C(=O)N2C(C(=O)OC(C)OC(C)=O)=C(COC(N)=O)CS[C@H]12)/c1ccoc1 |
| InChI | InChI=1S/C20H22N4O10S/c1-9(25)33-10(2)34-19(28)15-12(7-32-20(21)29)8-35-18-14(17(27)24(15)18)22-16(26)13(23-30-3)11-4-5-31-6-11/h4-6,10,14,18H,7-8H2,1-3H3,(H2,21,29)(H,22,26)/p-1/b23-13-/t10?,14-,18-/m1/s1 |
| InChIKey | PZMXOYCEXZYRTD-YJBYXUATSA-M |
| XLogP | -0.53 |
| TPSA | 195.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.47 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|