C22H26N4O10S — CID 172960715
1-acetyloxyethyl (7R)-3-(carbamoyloxymethyl)-7-[[(2Z)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-6,7-dimethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 172960715) has the molecular formula C22H26N4O10S and a molecular weight of 538.54 g/mol. Its IUPAC name is 1-acetyloxyethyl (7R)-3-(carbamoyloxymethyl)-7-[[(2Z)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-6,7-dimethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | 1-acetyloxyethyl (7R)-3-(carbamoyloxymethyl)-7-[[(2Z)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-6,7-dimethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 172960715 |
| Molecular Formula | C22H26N4O10S |
| Molecular Weight | 538.54 g/mol |
| Exact Mass | 538.14 |
| IUPAC Name | 1-acetyloxyethyl (7R)-3-(carbamoyloxymethyl)-7-[[(2Z)-2-(furan-2-yl)-2-methoxyiminoacetyl]amino]-6,7-dimethyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CO/N=C(\C(=O)N[C@]1(C)C(=O)N2C(C(=O)OC(C)OC(C)=O)=C(COC(N)=O)CSC21C)c1ccco1 |
| InChI | InChI=1S/C22H26N4O10S/c1-11(27)35-12(2)36-18(29)16-13(9-34-20(23)31)10-37-22(4)21(3,19(30)26(16)22)24-17(28)15(25-32-5)14-7-6-8-33-14/h6-8,12H,9-10H2,1-5H3,(H2,23,31)(H,24,28)/b25-15-/t12?,21-,22?/m1/s1 |
| InChIKey | YAZAMYKQDMQMOA-HBRFOTESSA-N |
| XLogP | 0.61 |
| TPSA | 189.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.54 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|