C22H24F4N8O — CID 172988794
N-cyclopropyl-N-[(3S,4R)-3-fluoro-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-5-[methyl-[(Z)-(methylideneamino)methylideneamino]amino]pyrazine-2-carboxamide (PubChem CID 172988794) has the molecular formula C22H24F4N8O and a molecular weight of 492.48 g/mol. Its IUPAC name is N-cyclopropyl-N-[(3S,4R)-3-fluoro-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-5-[methyl-[(Z)-(methylideneamino)methylideneamino]amino]pyrazine-2-carboxamide.
| Compound Name | N-cyclopropyl-N-[(3S,4R)-3-fluoro-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-5-[methyl-[(Z)-(methylideneamino)methylideneamino]amino]pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 172988794 |
| Molecular Formula | C22H24F4N8O |
| Molecular Weight | 492.48 g/mol |
| Exact Mass | 492.20 |
| IUPAC Name | N-cyclopropyl-N-[(3S,4R)-3-fluoro-1-[5-(trifluoromethyl)-2-pyridinyl]piperidin-4-yl]-5-[methyl-[(Z)-(methylideneamino)methylideneamino]amino]pyrazine-2-carboxamide |
| SMILES | C=N/C=N\N(C)c1cnc(C(=O)N(C2CC2)[C@@H]2CCN(c3ccc(C(F)(F)F)cn3)C[C@@H]2F)cn1 |
| InChI | InChI=1S/C22H24F4N8O/c1-27-13-31-32(2)20-11-28-17(10-30-20)21(35)34(15-4-5-15)18-7-8-33(12-16(18)23)19-6-3-14(9-29-19)22(24,25)26/h3,6,9-11,13,15-16,18H,1,4-5,7-8,12H2,2H3/b31-13-/t16-,18+/m0/s1 |
| InChIKey | LRPNMIIMXSUVJI-FPDYLOQKSA-N |
| XLogP | 3.19 |
| TPSA | 90.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.48 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|