C14H16BrFN2O4S2 — CID 172991077
1-[8-(4-bromo-3-fluorophenyl)sulfonyl-5-oxa-2,8-diazaspiro[3.5]nonan-2-yl]-2-sulfanylethanone (PubChem CID 172991077) has the molecular formula C14H16BrFN2O4S2 and a molecular weight of 439.33 g/mol. Its IUPAC name is 1-[8-(4-bromo-3-fluorophenyl)sulfonyl-5-oxa-2,8-diazaspiro[3.5]nonan-2-yl]-2-sulfanylethanone.
| Compound Name | 1-[8-(4-bromo-3-fluorophenyl)sulfonyl-5-oxa-2,8-diazaspiro[3.5]nonan-2-yl]-2-sulfanylethanone |
|---|---|
| PubChem CID | 172991077 |
| Molecular Formula | C14H16BrFN2O4S2 |
| Molecular Weight | 439.33 g/mol |
| Exact Mass | 437.97 |
| IUPAC Name | 1-[8-(4-bromo-3-fluorophenyl)sulfonyl-5-oxa-2,8-diazaspiro[3.5]nonan-2-yl]-2-sulfanylethanone |
| SMILES | O=C(CS)N1CC2(C1)CN(S(=O)(=O)c1ccc(Br)c(F)c1)CCO2 |
| InChI | InChI=1S/C14H16BrFN2O4S2/c15-11-2-1-10(5-12(11)16)24(20,21)18-3-4-22-14(9-18)7-17(8-14)13(19)6-23/h1-2,5,23H,3-4,6-9H2 |
| InChIKey | KEUFBACTGFISQT-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 66.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.33 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|