C14H17BrN2O4S2 — CID 172876331
1-[8-(4-bromophenyl)sulfonyl-5-oxa-2,8-diazaspiro[3.5]nonan-2-yl]-2-sulfanylethanone (PubChem CID 172876331) has the molecular formula C14H17BrN2O4S2 and a molecular weight of 421.34 g/mol. Its IUPAC name is 1-[8-(4-bromophenyl)sulfonyl-5-oxa-2,8-diazaspiro[3.5]nonan-2-yl]-2-sulfanylethanone.
| Compound Name | 1-[8-(4-bromophenyl)sulfonyl-5-oxa-2,8-diazaspiro[3.5]nonan-2-yl]-2-sulfanylethanone |
|---|---|
| PubChem CID | 172876331 |
| Molecular Formula | C14H17BrN2O4S2 |
| Molecular Weight | 421.34 g/mol |
| Exact Mass | 419.98 |
| IUPAC Name | 1-[8-(4-bromophenyl)sulfonyl-5-oxa-2,8-diazaspiro[3.5]nonan-2-yl]-2-sulfanylethanone |
| SMILES | O=C(CS)N1CC2(C1)CN(S(=O)(=O)c1ccc(Br)cc1)CCO2 |
| InChI | InChI=1S/C14H17BrN2O4S2/c15-11-1-3-12(4-2-11)23(19,20)17-5-6-21-14(10-17)8-16(9-14)13(18)7-22/h1-4,22H,5-10H2 |
| InChIKey | KPLWKHRWCVIMDF-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 66.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|