C22H21N3O4 — CID 172991397
2-[4-[[4-(3-hydroxybut-1-ynyl)phenoxy]methyl]triazol-1-yl]-1-(4-methoxyphenyl)ethanone (PubChem CID 172991397) has the molecular formula C22H21N3O4 and a molecular weight of 391.43 g/mol. Its IUPAC name is 2-[4-[[4-(3-hydroxybut-1-ynyl)phenoxy]methyl]triazol-1-yl]-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-[4-[[4-(3-hydroxybut-1-ynyl)phenoxy]methyl]triazol-1-yl]-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 172991397 |
| Molecular Formula | C22H21N3O4 |
| Molecular Weight | 391.43 g/mol |
| Exact Mass | 391.15 |
| IUPAC Name | 2-[4-[[4-(3-hydroxybut-1-ynyl)phenoxy]methyl]triazol-1-yl]-1-(4-methoxyphenyl)ethanone |
| SMILES | COc1ccc(C(=O)Cn2cc(COc3ccc(C#CC(C)O)cc3)nn2)cc1 |
| InChI | InChI=1S/C22H21N3O4/c1-16(26)3-4-17-5-9-21(10-6-17)29-15-19-13-25(24-23-19)14-22(27)18-7-11-20(28-2)12-8-18/h5-13,16,26H,14-15H2,1-2H3 |
| InChIKey | XQSBWMSZYXFDHF-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 86.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.43 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|