C23H26N2O2 — CID 172993928
2-(1-hexylpyrazol-4-yl)-6-phenylmethoxybenzaldehyde (PubChem CID 172993928) has the molecular formula C23H26N2O2 and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-(1-hexylpyrazol-4-yl)-6-phenylmethoxybenzaldehyde.
| Compound Name | 2-(1-hexylpyrazol-4-yl)-6-phenylmethoxybenzaldehyde |
|---|---|
| PubChem CID | 172993928 |
| Molecular Formula | C23H26N2O2 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.20 |
| IUPAC Name | 2-(1-hexylpyrazol-4-yl)-6-phenylmethoxybenzaldehyde |
| SMILES | CCCCCCn1cc(-c2cccc(OCc3ccccc3)c2C=O)cn1 |
| InChI | InChI=1S/C23H26N2O2/c1-2-3-4-8-14-25-16-20(15-24-25)21-12-9-13-23(22(21)17-26)27-18-19-10-6-5-7-11-19/h5-7,9-13,15-17H,2-4,8,14,18H2,1H3 |
| InChIKey | VDCKNUCFWJEKFP-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|