C20H14Cl2O2 — CID 172993959
2-(3,5-dichlorophenyl)-6-phenylmethoxybenzaldehyde (PubChem CID 172993959) has the molecular formula C20H14Cl2O2 and a molecular weight of 357.24 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-6-phenylmethoxybenzaldehyde.
| Compound Name | 2-(3,5-dichlorophenyl)-6-phenylmethoxybenzaldehyde |
|---|---|
| PubChem CID | 172993959 |
| Molecular Formula | C20H14Cl2O2 |
| Molecular Weight | 357.24 g/mol |
| Exact Mass | 356.04 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-6-phenylmethoxybenzaldehyde |
| SMILES | O=Cc1c(OCc2ccccc2)cccc1-c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C20H14Cl2O2/c21-16-9-15(10-17(22)11-16)18-7-4-8-20(19(18)12-23)24-13-14-5-2-1-3-6-14/h1-12H,13H2 |
| InChIKey | BUAQWUMNDPGRAF-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.24 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|