C20H17Cl2NO — CID 176508500
[4-(3,5-dichlorophenyl)-3-phenylmethoxyphenyl]methanamine (PubChem CID 176508500) has the molecular formula C20H17Cl2NO and a molecular weight of 358.27 g/mol. Its IUPAC name is [4-(3,5-dichlorophenyl)-3-phenylmethoxyphenyl]methanamine.
| Compound Name | [4-(3,5-dichlorophenyl)-3-phenylmethoxyphenyl]methanamine |
|---|---|
| PubChem CID | 176508500 |
| Molecular Formula | C20H17Cl2NO |
| Molecular Weight | 358.27 g/mol |
| Exact Mass | 357.07 |
| IUPAC Name | [4-(3,5-dichlorophenyl)-3-phenylmethoxyphenyl]methanamine |
| SMILES | NCc1ccc(-c2cc(Cl)cc(Cl)c2)c(OCc2ccccc2)c1 |
| InChI | InChI=1S/C20H17Cl2NO/c21-17-9-16(10-18(22)11-17)19-7-6-15(12-23)8-20(19)24-13-14-4-2-1-3-5-14/h1-11H,12-13,23H2 |
| InChIKey | QEPYSJKGBNHQNA-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.27 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |