C21H23NO10S2 — CID 172994769
(2S,3S)-2-[(2,7-disulfo-9H-fluoren-9-yl)methoxycarbonylamino]-3-methylpentanoic acid (PubChem CID 172994769) has the molecular formula C21H23NO10S2 and a molecular weight of 513.55 g/mol. Its IUPAC name is (2S,3S)-2-[(2,7-disulfo-9H-fluoren-9-yl)methoxycarbonylamino]-3-methylpentanoic acid.
| Compound Name | (2S,3S)-2-[(2,7-disulfo-9H-fluoren-9-yl)methoxycarbonylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 172994769 |
| Molecular Formula | C21H23NO10S2 |
| Molecular Weight | 513.55 g/mol |
| Exact Mass | 513.08 |
| IUPAC Name | (2S,3S)-2-[(2,7-disulfo-9H-fluoren-9-yl)methoxycarbonylamino]-3-methylpentanoic acid |
| SMILES | CC[C@H](C)[C@H](NC(=O)OCC1c2cc(S(=O)(=O)O)ccc2-c2ccc(S(=O)(=O)O)cc21)C(=O)O |
| InChI | InChI=1S/C21H23NO10S2/c1-3-11(2)19(20(23)24)22-21(25)32-10-18-16-8-12(33(26,27)28)4-6-14(16)15-7-5-13(9-17(15)18)34(29,30)31/h4-9,11,18-19H,3,10H2,1-2H3,(H,22,25)(H,23,24)(H,26,27,28)(H,29,30,31)/t11-,19-/m0/s1 |
| InChIKey | BCGXQCUJZNNNPE-WLRWDXFRSA-N |
| XLogP | 2.52 |
| TPSA | 184.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|