About magnesium;acetic acid;hydride
magnesium;acetic acid;hydride (PubChem CID 172995175) has the molecular formula C2H6MgO2
and a molecular weight of 86.37 g/mol. Its IUPAC name is magnesium;acetic acid;hydride.
Molecular Properties
| Compound Name | magnesium;acetic acid;hydride |
| PubChem CID | 172995175 |
| Molecular Formula | C2H6MgO2 |
| Molecular Weight | 86.37 g/mol |
| Exact Mass | 86.02 |
| IUPAC Name | magnesium;acetic acid;hydride |
| SMILES | CC(=O)O.[H-].[H-].[Mg+2] |
| InChI | InChI=1S/C2H4O2.Mg.2H/c1-2(3)4;;;/h1H3,(H,3,4);;;/q;+2;2*-1 |
| InChIKey | YIAYCVKBYHTMON-UHFFFAOYSA-N |
| XLogP | -0.06 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 86.37 |
| LogP ≤ 5 | -0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze magnesium;acetic acid;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;acetic acid;hydride?
The IUPAC name of magnesium;acetic acid;hydride (CID 172995175) is magnesium;acetic acid;hydride.
What is the SMILES notation for magnesium;acetic acid;hydride?
The canonical SMILES for magnesium;acetic acid;hydride is CC(=O)O.[H-].[H-].[Mg+2].
What is the InChIKey of magnesium;acetic acid;hydride?
The InChIKey is YIAYCVKBYHTMON-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.Mg.2H/c1-2(3)4;;;/h1H3,(H,3,4);;;/q;+2;2*-1.
What are the key properties of magnesium;acetic acid;hydride?
magnesium;acetic acid;hydride has a molecular weight of 86.37 g/mol, XLogP of -0.06, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;acetic acid;hydride is sourced from PubChem (CID 172995175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).