About acetic acid;hydride;nickel
acetic acid;hydride;nickel (PubChem CID 173448047) has the molecular formula C2H8NiO2-4
and a molecular weight of 122.78 g/mol. Its IUPAC name is acetic acid;hydride;nickel.
Molecular Properties
| Compound Name | acetic acid;hydride;nickel |
| PubChem CID | 173448047 |
| Molecular Formula | C2H8NiO2-4 |
| Molecular Weight | 122.78 g/mol |
| Exact Mass | 121.99 |
| IUPAC Name | acetic acid;hydride;nickel |
| SMILES | CC(=O)O.[H-].[H-].[H-].[H-].[Ni] |
| InChI | InChI=1S/C2H4O2.Ni.4H/c1-2(3)4;;;;;/h1H3,(H,3,4);;;;;/q;;4*-1 |
| InChIKey | GQJYSSSMJZEFEH-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.78 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetic acid;hydride;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;hydride;nickel?
The IUPAC name of acetic acid;hydride;nickel (CID 173448047) is acetic acid;hydride;nickel.
What is the SMILES notation for acetic acid;hydride;nickel?
The canonical SMILES for acetic acid;hydride;nickel is CC(=O)O.[H-].[H-].[H-].[H-].[Ni].
What is the InChIKey of acetic acid;hydride;nickel?
The InChIKey is GQJYSSSMJZEFEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4O2.Ni.4H/c1-2(3)4;;;;;/h1H3,(H,3,4);;;;;/q;;4*-1.
What are the key properties of acetic acid;hydride;nickel?
acetic acid;hydride;nickel has a molecular weight of 122.78 g/mol, XLogP of 0.54, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;hydride;nickel is sourced from PubChem (CID 173448047), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).