C15H22BrClN2S — CID 17299786
3-(4-bromo-2-chlorophenyl)-1,1-di(butan-2-yl)thiourea (PubChem CID 17299786) has the molecular formula C15H22BrClN2S and a molecular weight of 377.78 g/mol. Its IUPAC name is 3-(4-bromo-2-chlorophenyl)-1,1-di(butan-2-yl)thiourea.
| Compound Name | 3-(4-bromo-2-chlorophenyl)-1,1-di(butan-2-yl)thiourea |
|---|---|
| PubChem CID | 17299786 |
| Molecular Formula | C15H22BrClN2S |
| Molecular Weight | 377.78 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 3-(4-bromo-2-chlorophenyl)-1,1-di(butan-2-yl)thiourea |
| SMILES | CCC(C)N(C(=S)Nc1ccc(Br)cc1Cl)C(C)CC |
| InChI | InChI=1S/C15H22BrClN2S/c1-5-10(3)19(11(4)6-2)15(20)18-14-8-7-12(16)9-13(14)17/h7-11H,5-6H2,1-4H3,(H,18,20) |
| InChIKey | INGRURIVCQFXGL-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.78 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|