C22H37NNa2O8S — CID 172998046
disodium;2-(octadec-9-enoylamino)-2-sulfobutanedioate (PubChem CID 172998046) has the molecular formula C22H37NNa2O8S and a molecular weight of 521.58 g/mol. Its IUPAC name is disodium;2-(octadec-9-enoylamino)-2-sulfobutanedioate.
| Compound Name | disodium;2-(octadec-9-enoylamino)-2-sulfobutanedioate |
|---|---|
| PubChem CID | 172998046 |
| Molecular Formula | C22H37NNa2O8S |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 521.20 |
| IUPAC Name | disodium;2-(octadec-9-enoylamino)-2-sulfobutanedioate |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)NC(CC(=O)[O-])(C(=O)[O-])S(=O)(=O)O.[Na+].[Na+] |
| InChI | InChI=1S/C22H39NO8S.2Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(24)23-22(21(27)28,18-20(25)26)32(29,30)31;;/h9-10H,2-8,11-18H2,1H3,(H,23,24)(H,25,26)(H,27,28)(H,29,30,31);;/q;2*+1/p-2 |
| InChIKey | GFTHFTCNWNKOQP-UHFFFAOYSA-L |
| XLogP | -4.38 |
| TPSA | 163.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | -4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|