C23H45F3N2O5S — CID 167616549
methane;2-[[(Z)-octadec-9-enoyl]sulfamoyl]ethylazanium;2,2,2-trifluoroacetate (PubChem CID 167616549) has the molecular formula C23H45F3N2O5S and a molecular weight of 518.68 g/mol. Its IUPAC name is methane;2-[[(Z)-octadec-9-enoyl]sulfamoyl]ethylazanium;2,2,2-trifluoroacetate.
| Compound Name | methane;2-[[(Z)-octadec-9-enoyl]sulfamoyl]ethylazanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 167616549 |
| Molecular Formula | C23H45F3N2O5S |
| Molecular Weight | 518.68 g/mol |
| Exact Mass | 518.30 |
| IUPAC Name | methane;2-[[(Z)-octadec-9-enoyl]sulfamoyl]ethylazanium;2,2,2-trifluoroacetate |
| SMILES | C.CCCCCCCC/C=C\CCCCCCCC(=O)NS(=O)(=O)CC[NH3+].O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C20H40N2O3S.C2HF3O2.CH4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)22-26(24,25)19-18-21;3-2(4,5)1(6)7;/h9-10H,2-8,11-19,21H2,1H3,(H,22,23);(H,6,7);1H4/b10-9-;; |
| InChIKey | GIBCJILOARCFPH-XXAVUKJNSA-N |
| XLogP | 3.65 |
| TPSA | 131.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.68 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|